C12H8N2OS — CID 137177094
3-(1,3-benzoxazol-2-yl)-1H-pyridine-2-thione (PubChem CID 137177094) has the molecular formula C12H8N2OS and a molecular weight of 228.28 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-1H-pyridine-2-thione.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 137177094 |
| Molecular Formula | C12H8N2OS |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-1H-pyridine-2-thione |
| SMILES | S=c1[nH]cccc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C12H8N2OS/c16-12-8(4-3-7-13-12)11-14-9-5-1-2-6-10(9)15-11/h1-7H,(H,13,16) |
| InChIKey | UGULIRIVNDXBOV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|