About 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one
3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one (PubChem CID 136812652) has the molecular formula C7H4IN3O2
and a molecular weight of 289.03 g/mol. Its IUPAC name is 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one |
| PubChem CID | 136812652 |
| Molecular Formula | C7H4IN3O2 |
| Molecular Weight | 289.03 g/mol |
| Exact Mass | 288.93 |
| IUPAC Name | 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one |
| SMILES | O=c1cc[nH]cc1-c1nc(I)no1 |
| InChI | InChI=1S/C7H4IN3O2/c8-7-10-6(13-11-7)4-3-9-2-1-5(4)12/h1-3H,(H,9,12) |
| InChIKey | NUWQIRLOZAUKKJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.03 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one?
The IUPAC name of 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one (CID 136812652) is 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one.
What is the SMILES notation for 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one?
The canonical SMILES for 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one is O=c1cc[nH]cc1-c1nc(I)no1.
What is the InChIKey of 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one?
The InChIKey is NUWQIRLOZAUKKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4IN3O2/c8-7-10-6(13-11-7)4-3-9-2-1-5(4)12/h1-3H,(H,9,12).
What are the key properties of 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one?
3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one has a molecular weight of 289.03 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-iodo-1,2,4-oxadiazol-5-yl)-1H-pyridin-4-one is sourced from PubChem (CID 136812652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).