C22H12N2O4 — CID 68742008
2-[2-(4-oxo-1,3-benzoxazin-2-yl)phenyl]-1,3-benzoxazin-4-one (PubChem CID 68742008) has the molecular formula C22H12N2O4 and a molecular weight of 368.35 g/mol. Its IUPAC name is 2-[2-(4-oxo-1,3-benzoxazin-2-yl)phenyl]-1,3-benzoxazin-4-one.
| Compound Name | 2-[2-(4-oxo-1,3-benzoxazin-2-yl)phenyl]-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 68742008 |
| Molecular Formula | C22H12N2O4 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2-[2-(4-oxo-1,3-benzoxazin-2-yl)phenyl]-1,3-benzoxazin-4-one |
| SMILES | O=c1nc(-c2ccccc2-c2nc(=O)c3ccccc3o2)oc2ccccc12 |
| InChI | InChI=1S/C22H12N2O4/c25-19-15-9-3-5-11-17(15)27-21(23-19)13-7-1-2-8-14(13)22-24-20(26)16-10-4-6-12-18(16)28-22/h1-12H |
| InChIKey | RIIXBORUURBCJT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |