C16H14N2O2 — CID 59485236
2-(N-ethylanilino)-1,3-benzoxazin-4-one (PubChem CID 59485236) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(N-ethylanilino)-1,3-benzoxazin-4-one.
| Compound Name | 2-(N-ethylanilino)-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 59485236 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-(N-ethylanilino)-1,3-benzoxazin-4-one |
| SMILES | CCN(c1ccccc1)c1nc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C16H14N2O2/c1-2-18(12-8-4-3-5-9-12)16-17-15(19)13-10-6-7-11-14(13)20-16/h3-11H,2H2,1H3 |
| InChIKey | CIPNWZWDKHCBEX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |