C14H9NO3 — CID 135685723
2-(2-hydroxyphenyl)-1,3-benzoxazin-4-one (PubChem CID 135685723) has the molecular formula C14H9NO3 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-1,3-benzoxazin-4-one.
| Compound Name | 2-(2-hydroxyphenyl)-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 135685723 |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-(2-hydroxyphenyl)-1,3-benzoxazin-4-one |
| SMILES | O=c1nc(-c2ccccc2O)oc2ccccc12 |
| InChI | InChI=1S/C14H9NO3/c16-11-7-3-1-5-9(11)14-15-13(17)10-6-2-4-8-12(10)18-14/h1-8,16H |
| InChIKey | NSWIROGSZPXREF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |