C13H8NO2Zn- — CID 152729544
2-(4H-1,3-benzoxazol-4-id-2-yl)phenol;zinc (PubChem CID 152729544) has the molecular formula C13H8NO2Zn- and a molecular weight of 275.60 g/mol. Its IUPAC name is 2-(4H-1,3-benzoxazol-4-id-2-yl)phenol;zinc.
| Compound Name | 2-(4H-1,3-benzoxazol-4-id-2-yl)phenol;zinc |
|---|---|
| PubChem CID | 152729544 |
| Molecular Formula | C13H8NO2Zn- |
| Molecular Weight | 275.60 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 2-(4H-1,3-benzoxazol-4-id-2-yl)phenol;zinc |
| SMILES | Oc1ccccc1-c1nc2[c-]cccc2o1.[Zn] |
| InChI | InChI=1S/C13H8NO2.Zn/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13;/h1-5,7-8,15H;/q-1; |
| InChIKey | NQMAOXNMQHUFSA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|