C34H22N2O4Pd — CID 139246627
bis(2-benzo[e][1,3]benzoxazol-2-ylphenol);palladium (PubChem CID 139246627) has the molecular formula C34H22N2O4Pd and a molecular weight of 628.98 g/mol. Its IUPAC name is bis(2-benzo[e][1,3]benzoxazol-2-ylphenol);palladium.
| Compound Name | bis(2-benzo[e][1,3]benzoxazol-2-ylphenol);palladium |
|---|---|
| PubChem CID | 139246627 |
| Molecular Formula | C34H22N2O4Pd |
| Molecular Weight | 628.98 g/mol |
| Exact Mass | 628.06 |
| IUPAC Name | bis(2-benzo[e][1,3]benzoxazol-2-ylphenol);palladium |
| SMILES | Oc1ccccc1-c1nc2c(ccc3ccccc32)o1.Oc1ccccc1-c1nc2c(ccc3ccccc32)o1.[Pd] |
| InChI | InChI=1S/2C17H11NO2.Pd/c2*19-14-8-4-3-7-13(14)17-18-16-12-6-2-1-5-11(12)9-10-15(16)20-17;/h2*1-10,19H; |
| InChIKey | LFBZKNHYDAUWQC-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.98 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |