C18H20N2O — CID 57475909
N-(3-methylbutyl)-N-phenyl-1,3-benzoxazol-2-amine (PubChem CID 57475909) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(3-methylbutyl)-N-phenyl-1,3-benzoxazol-2-amine.
| Compound Name | N-(3-methylbutyl)-N-phenyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 57475909 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-(3-methylbutyl)-N-phenyl-1,3-benzoxazol-2-amine |
| SMILES | CC(C)CCN(c1ccccc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C18H20N2O/c1-14(2)12-13-20(15-8-4-3-5-9-15)18-19-16-10-6-7-11-17(16)21-18/h3-11,14H,12-13H2,1-2H3 |
| InChIKey | KBLRHVNUMMIVFW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |