C16H16N2O2 — CID 60979792
2-[1,3-benzoxazol-2-yl(benzyl)amino]ethanol (PubChem CID 60979792) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[1,3-benzoxazol-2-yl(benzyl)amino]ethanol.
| Compound Name | 2-[1,3-benzoxazol-2-yl(benzyl)amino]ethanol |
|---|---|
| PubChem CID | 60979792 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[1,3-benzoxazol-2-yl(benzyl)amino]ethanol |
| SMILES | OCCN(Cc1ccccc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C16H16N2O2/c19-11-10-18(12-13-6-2-1-3-7-13)16-17-14-8-4-5-9-15(14)20-16/h1-9,19H,10-12H2 |
| InChIKey | HWAJGNAFFKWSDP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |