C13H16ClN3O2 — CID 106957491
2-[benzyl-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethanol (PubChem CID 106957491) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-[benzyl-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethanol.
| Compound Name | 2-[benzyl-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 106957491 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[benzyl-[5-(2-chloroethyl)-1,3,4-oxadiazol-2-yl]amino]ethanol |
| SMILES | OCCN(Cc1ccccc1)c1nnc(CCCl)o1 |
| InChI | InChI=1S/C13H16ClN3O2/c14-7-6-12-15-16-13(19-12)17(8-9-18)10-11-4-2-1-3-5-11/h1-5,18H,6-10H2 |
| InChIKey | QMQCTZPPXMNYRP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|