C14H15Cl2N3O — CID 102757794
2-[(6-amino-3,5-dichloro-2-pyridinyl)-benzylamino]ethanol (PubChem CID 102757794) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 2-[(6-amino-3,5-dichloro-2-pyridinyl)-benzylamino]ethanol.
| Compound Name | 2-[(6-amino-3,5-dichloro-2-pyridinyl)-benzylamino]ethanol |
|---|---|
| PubChem CID | 102757794 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-[(6-amino-3,5-dichloro-2-pyridinyl)-benzylamino]ethanol |
| SMILES | Nc1nc(N(CCO)Cc2ccccc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2N3O/c15-11-8-12(16)14(18-13(11)17)19(6-7-20)9-10-4-2-1-3-5-10/h1-5,8,20H,6-7,9H2,(H2,17,18) |
| InChIKey | PVGLPELYPCIXAZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |