C15H17N5O — CID 80796932
2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-benzylamino]ethanol (PubChem CID 80796932) has the molecular formula C15H17N5O and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-benzylamino]ethanol.
| Compound Name | 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-benzylamino]ethanol |
|---|---|
| PubChem CID | 80796932 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)-benzylamino]ethanol |
| SMILES | Nc1cn2ccnc2c(N(CCO)Cc2ccccc2)n1 |
| InChI | InChI=1S/C15H17N5O/c16-13-11-19-7-6-17-14(19)15(18-13)20(8-9-21)10-12-4-2-1-3-5-12/h1-7,11,21H,8-10,16H2 |
| InChIKey | DLASUNNFMXPDSM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |