C7H12ClN3O2 — CID 106956824
2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]ethanol (PubChem CID 106956824) has the molecular formula C7H12ClN3O2 and a molecular weight of 205.64 g/mol. Its IUPAC name is 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]ethanol.
| Compound Name | 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]ethanol |
|---|---|
| PubChem CID | 106956824 |
| Molecular Formula | C7H12ClN3O2 |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 2-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]ethanol |
| SMILES | CCN(CCO)c1nnc(CCl)o1 |
| InChI | InChI=1S/C7H12ClN3O2/c1-2-11(3-4-12)7-10-9-6(5-8)13-7/h12H,2-5H2,1H3 |
| InChIKey | RMMCRVXTHRTIIS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|