C9H16ClN3O2 — CID 106958613
3-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]propan-1-ol (PubChem CID 106958613) has the molecular formula C9H16ClN3O2 and a molecular weight of 233.70 g/mol. Its IUPAC name is 3-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]propan-1-ol.
| Compound Name | 3-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 106958613 |
| Molecular Formula | C9H16ClN3O2 |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]propan-1-ol |
| SMILES | CCN(CCCO)c1nnc(C(C)Cl)o1 |
| InChI | InChI=1S/C9H16ClN3O2/c1-3-13(5-4-6-14)9-12-11-8(15-9)7(2)10/h7,14H,3-6H2,1-2H3 |
| InChIKey | LYZHXKHJFRHPIG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|