C8H11ClF3N3O2 — CID 107495556
2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-(2,2,2-trifluoroethyl)amino]ethanol (PubChem CID 107495556) has the molecular formula C8H11ClF3N3O2 and a molecular weight of 273.64 g/mol. Its IUPAC name is 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-(2,2,2-trifluoroethyl)amino]ethanol.
| Compound Name | 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-(2,2,2-trifluoroethyl)amino]ethanol |
|---|---|
| PubChem CID | 107495556 |
| Molecular Formula | C8H11ClF3N3O2 |
| Molecular Weight | 273.64 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-[[5-(1-chloroethyl)-1,3,4-oxadiazol-2-yl]-(2,2,2-trifluoroethyl)amino]ethanol |
| SMILES | CC(Cl)c1nnc(N(CCO)CC(F)(F)F)o1 |
| InChI | InChI=1S/C8H11ClF3N3O2/c1-5(9)6-13-14-7(17-6)15(2-3-16)4-8(10,11)12/h5,16H,2-4H2,1H3 |
| InChIKey | VKCIJZOXMYSVLS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.64 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|