C8H11ClF3N3O — CID 106958009
5-(1-chloroethyl)-N-methyl-N-(3,3,3-trifluoropropyl)-1,3,4-oxadiazol-2-amine (PubChem CID 106958009) has the molecular formula C8H11ClF3N3O and a molecular weight of 257.64 g/mol. Its IUPAC name is 5-(1-chloroethyl)-N-methyl-N-(3,3,3-trifluoropropyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(1-chloroethyl)-N-methyl-N-(3,3,3-trifluoropropyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106958009 |
| Molecular Formula | C8H11ClF3N3O |
| Molecular Weight | 257.64 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 5-(1-chloroethyl)-N-methyl-N-(3,3,3-trifluoropropyl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC(Cl)c1nnc(N(C)CCC(F)(F)F)o1 |
| InChI | InChI=1S/C8H11ClF3N3O/c1-5(9)6-13-14-7(16-6)15(2)4-3-8(10,11)12/h5H,3-4H2,1-2H3 |
| InChIKey | IDUHIDFDVVFBQB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.64 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|