C8H14ClN3O2 — CID 106958612
3-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]propan-1-ol (PubChem CID 106958612) has the molecular formula C8H14ClN3O2 and a molecular weight of 219.67 g/mol. Its IUPAC name is 3-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]propan-1-ol.
| Compound Name | 3-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 106958612 |
| Molecular Formula | C8H14ClN3O2 |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-[[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-ethylamino]propan-1-ol |
| SMILES | CCN(CCCO)c1nnc(CCl)o1 |
| InChI | InChI=1S/C8H14ClN3O2/c1-2-12(4-3-5-13)8-11-10-7(6-9)14-8/h13H,2-6H2,1H3 |
| InChIKey | MAJLGBIHMDSURK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|