C12H15ClN4O — CID 106958149
5-(chloromethyl)-N-ethyl-N-[(6-methyl-2-pyridinyl)methyl]-1,3,4-oxadiazol-2-amine (PubChem CID 106958149) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is 5-(chloromethyl)-N-ethyl-N-[(6-methyl-2-pyridinyl)methyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(chloromethyl)-N-ethyl-N-[(6-methyl-2-pyridinyl)methyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106958149 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-(chloromethyl)-N-ethyl-N-[(6-methyl-2-pyridinyl)methyl]-1,3,4-oxadiazol-2-amine |
| SMILES | CCN(Cc1cccc(C)n1)c1nnc(CCl)o1 |
| InChI | InChI=1S/C12H15ClN4O/c1-3-17(12-16-15-11(7-13)18-12)8-10-6-4-5-9(2)14-10/h4-6H,3,7-8H2,1-2H3 |
| InChIKey | XQCXBBRHOJJDPJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|