C14H9NO2S — CID 4888492
2-(2-thiophen-2-ylethenyl)-1,3-benzoxazin-4-one (PubChem CID 4888492) has the molecular formula C14H9NO2S and a molecular weight of 255.30 g/mol. Its IUPAC name is 2-(2-thiophen-2-ylethenyl)-1,3-benzoxazin-4-one.
| Compound Name | 2-(2-thiophen-2-ylethenyl)-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 4888492 |
| Molecular Formula | C14H9NO2S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 2-(2-thiophen-2-ylethenyl)-1,3-benzoxazin-4-one |
| SMILES | O=c1nc(C=Cc2cccs2)oc2ccccc12 |
| InChI | InChI=1S/C14H9NO2S/c16-14-11-5-1-2-6-12(11)17-13(15-14)8-7-10-4-3-9-18-10/h1-9H |
| InChIKey | NXYKCVGBQHXTOZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |