C28H20N2S4 — CID 19937826
2,3,5,6-tetrakis[(E)-2-thiophen-2-ylethenyl]pyrazine (PubChem CID 19937826) has the molecular formula C28H20N2S4 and a molecular weight of 512.75 g/mol. Its IUPAC name is 2,3,5,6-tetrakis[(E)-2-thiophen-2-ylethenyl]pyrazine.
| Compound Name | 2,3,5,6-tetrakis[(E)-2-thiophen-2-ylethenyl]pyrazine |
|---|---|
| PubChem CID | 19937826 |
| Molecular Formula | C28H20N2S4 |
| Molecular Weight | 512.75 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 2,3,5,6-tetrakis[(E)-2-thiophen-2-ylethenyl]pyrazine |
| SMILES | C(=C/c1nc(/C=C/c2cccs2)c(/C=C/c2cccs2)nc1/C=C/c1cccs1)\c1cccs1 |
| InChI | InChI=1S/C28H20N2S4/c1-5-21(31-17-1)9-13-25-26(14-10-22-6-2-18-32-22)30-28(16-12-24-8-4-20-34-24)27(29-25)15-11-23-7-3-19-33-23/h1-20H/b13-9+,14-10+,15-11+,16-12+ |
| InChIKey | WFYSMXDVVXEEBF-KUWVSJDVSA-N |
| XLogP | 9.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.75 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |