About CID 11426392
CID 11426392 (PubChem CID 11426392) has the molecular formula C11H9S
and a molecular weight of 173.26 g/mol.
Molecular Properties
| Compound Name | CID 11426392 |
| PubChem CID | 11426392 |
| Molecular Formula | C11H9S |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C](/C=C/c2cccs2)[CH]1 |
| InChI | InChI=1S/C11H9S/c1-2-5-10(4-1)7-8-11-6-3-9-12-11/h1-9H/b8-7+ |
| InChIKey | ZTVOHDUTYZDMDG-BQYQJAHWSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 11426392 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11426392?
The IUPAC name of CID 11426392 (CID 11426392) is not available.
What is the SMILES notation for CID 11426392?
The canonical SMILES for CID 11426392 is [CH]1[CH][CH][C](/C=C/c2cccs2)[CH]1.
What is the InChIKey of CID 11426392?
The InChIKey is ZTVOHDUTYZDMDG-BQYQJAHWSA-N. The full InChI is InChI=1S/C11H9S/c1-2-5-10(4-1)7-8-11-6-3-9-12-11/h1-9H/b8-7+.
What are the key properties of CID 11426392?
CID 11426392 has a molecular weight of 173.26 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11426392 is sourced from PubChem (CID 11426392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).