C28H32N2S2 — CID 177477330
1-[4-piperidin-1-yl-2,5-bis[(E)-2-thiophen-2-ylethenyl]phenyl]piperidine (PubChem CID 177477330) has the molecular formula C28H32N2S2 and a molecular weight of 460.71 g/mol. Its IUPAC name is 1-[4-piperidin-1-yl-2,5-bis[(E)-2-thiophen-2-ylethenyl]phenyl]piperidine.
| Compound Name | 1-[4-piperidin-1-yl-2,5-bis[(E)-2-thiophen-2-ylethenyl]phenyl]piperidine |
|---|---|
| PubChem CID | 177477330 |
| Molecular Formula | C28H32N2S2 |
| Molecular Weight | 460.71 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 1-[4-piperidin-1-yl-2,5-bis[(E)-2-thiophen-2-ylethenyl]phenyl]piperidine |
| SMILES | C(=C/c1cc(N2CCCCC2)c(/C=C/c2cccs2)cc1N1CCCCC1)\c1cccs1 |
| InChI | InChI=1S/C28H32N2S2/c1-3-15-29(16-4-1)27-21-24(12-14-26-10-8-20-32-26)28(30-17-5-2-6-18-30)22-23(27)11-13-25-9-7-19-31-25/h7-14,19-22H,1-6,15-18H2/b13-11+,14-12+ |
| InChIKey | DVGYSJMUCATEMN-PHEQNACWSA-N |
| XLogP | 8.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.71 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |