C18H23N3O2S2 — CID 94849742
N,N-dimethyl-2-piperidin-1-yl-5-(thiophen-2-ylmethylideneamino)benzenesulfonamide (PubChem CID 94849742) has the molecular formula C18H23N3O2S2 and a molecular weight of 377.54 g/mol. Its IUPAC name is N,N-dimethyl-2-piperidin-1-yl-5-(thiophen-2-ylmethylideneamino)benzenesulfonamide.
| Compound Name | N,N-dimethyl-2-piperidin-1-yl-5-(thiophen-2-ylmethylideneamino)benzenesulfonamide |
|---|---|
| PubChem CID | 94849742 |
| Molecular Formula | C18H23N3O2S2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N,N-dimethyl-2-piperidin-1-yl-5-(thiophen-2-ylmethylideneamino)benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(/N=C/c2cccs2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C18H23N3O2S2/c1-20(2)25(22,23)18-13-15(19-14-16-7-6-12-24-16)8-9-17(18)21-10-4-3-5-11-21/h6-9,12-14H,3-5,10-11H2,1-2H3/b19-14+ |
| InChIKey | VHHKIHNAGUOQSV-XMHGGMMESA-N |
| XLogP | 3.74 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|