C27H37N3O4S — CID 94849754
5-(1,3-benzodioxol-5-ylmethylideneamino)-N,N-bis(2-methylpropyl)-2-piperidin-1-ylbenzenesulfonamide (PubChem CID 94849754) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylideneamino)-N,N-bis(2-methylpropyl)-2-piperidin-1-ylbenzenesulfonamide.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylideneamino)-N,N-bis(2-methylpropyl)-2-piperidin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 94849754 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylideneamino)-N,N-bis(2-methylpropyl)-2-piperidin-1-ylbenzenesulfonamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1cc(/N=C/c2ccc3c(c2)OCO3)ccc1N1CCCCC1 |
| InChI | InChI=1S/C27H37N3O4S/c1-20(2)17-30(18-21(3)4)35(31,32)27-15-23(9-10-24(27)29-12-6-5-7-13-29)28-16-22-8-11-25-26(14-22)34-19-33-25/h8-11,14-16,20-21H,5-7,12-13,17-19H2,1-4H3/b28-16+ |
| InChIKey | HTQNCMZOEXHVIJ-LQKURTRISA-N |
| XLogP | 5.46 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|