C13H16N2O2 — CID 714703
1-(1,3-benzodioxol-5-yl)-N-piperidin-1-ylmethanimine (PubChem CID 714703) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-piperidin-1-ylmethanimine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-piperidin-1-ylmethanimine |
|---|---|
| PubChem CID | 714703 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-piperidin-1-ylmethanimine |
| SMILES | C(=NN1CCCCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H16N2O2/c1-2-6-15(7-3-1)14-9-11-4-5-12-13(8-11)17-10-16-12/h4-5,8-9H,1-3,6-7,10H2 |
| InChIKey | ZLBMUMFDAHWGPV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|