C14H15NO2Se — CID 15832482
(E)-3-(1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylprop-2-ene-1-selone (PubChem CID 15832482) has the molecular formula C14H15NO2Se and a molecular weight of 308.24 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylprop-2-ene-1-selone.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylprop-2-ene-1-selone |
|---|---|
| PubChem CID | 15832482 |
| Molecular Formula | C14H15NO2Se |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-pyrrolidin-1-ylprop-2-ene-1-selone |
| SMILES | [Se]=C(/C=C/c1ccc2c(c1)OCO2)N1CCCC1 |
| InChI | InChI=1S/C14H15NO2Se/c18-14(15-7-1-2-8-15)6-4-11-3-5-12-13(9-11)17-10-16-12/h3-6,9H,1-2,7-8,10H2/b6-4+ |
| InChIKey | LCBXARZHJDHJGF-GQCTYLIASA-N |
| XLogP | 1.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|