C19H19ClN2O2 — CID 3562864
1-(1,3-benzodioxol-5-yl)-N-(3-chloro-4-piperidin-1-ylphenyl)methanimine (PubChem CID 3562864) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-(3-chloro-4-piperidin-1-ylphenyl)methanimine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-(3-chloro-4-piperidin-1-ylphenyl)methanimine |
|---|---|
| PubChem CID | 3562864 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-(3-chloro-4-piperidin-1-ylphenyl)methanimine |
| SMILES | Clc1cc(/N=C/c2ccc3c(c2)OCO3)ccc1N1CCCCC1 |
| InChI | InChI=1S/C19H19ClN2O2/c20-16-11-15(5-6-17(16)22-8-2-1-3-9-22)21-12-14-4-7-18-19(10-14)24-13-23-18/h4-7,10-12H,1-3,8-9,13H2/b21-12+ |
| InChIKey | AKCYTHLTOKTAKC-CIAFOILYSA-N |
| XLogP | 4.81 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|