C16H14FNO2 — CID 71525202
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-(4-fluorophenyl)methanimine (PubChem CID 71525202) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-(4-fluorophenyl)methanimine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-(4-fluorophenyl)methanimine |
|---|---|
| PubChem CID | 71525202 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-(4-fluorophenyl)methanimine |
| SMILES | Fc1ccc(/N=C/c2ccc3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C16H14FNO2/c17-13-3-5-14(6-4-13)18-11-12-2-7-15-16(10-12)20-9-1-8-19-15/h2-7,10-11H,1,8-9H2/b18-11+ |
| InChIKey | VDJYCYKODZMGSG-WOJGMQOQSA-N |
| XLogP | 3.74 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|