C10H9NO3 — CID 2776391
7-isocyanato-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 2776391) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 7-isocyanato-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-isocyanato-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 2776391 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 7-isocyanato-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | O=C=Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C10H9NO3/c12-7-11-8-2-3-9-10(6-8)14-5-1-4-13-9/h2-3,6H,1,4-5H2 |
| InChIKey | DUCMKSIKRPVTAJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|