C16H22O6 — CID 118122632
2,6,10,14-tetraoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl formate (PubChem CID 118122632) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2,6,10,14-tetraoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl formate.
| Compound Name | 2,6,10,14-tetraoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl formate |
|---|---|
| PubChem CID | 118122632 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2,6,10,14-tetraoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-yl formate |
| SMILES | O=COc1ccc2c(c1)OCCCOCCCOCCCO2 |
| InChI | InChI=1S/C16H22O6/c17-13-22-14-4-5-15-16(12-14)21-11-3-9-19-7-1-6-18-8-2-10-20-15/h4-5,12-13H,1-3,6-11H2 |
| InChIKey | KXUWSEQAAIANTP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|