C18H29NO6 — CID 14294022
2,6,9,12,15,19-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-trien-22-amine (PubChem CID 14294022) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is 2,6,9,12,15,19-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-trien-22-amine.
| Compound Name | 2,6,9,12,15,19-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-trien-22-amine |
|---|---|
| PubChem CID | 14294022 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2,6,9,12,15,19-hexaoxabicyclo[18.4.0]tetracosa-1(20),21,23-trien-22-amine |
| SMILES | Nc1ccc2c(c1)OCCCOCCOCCOCCOCCCO2 |
| InChI | InChI=1S/C18H29NO6/c19-16-3-4-17-18(15-16)25-8-2-6-21-10-12-23-14-13-22-11-9-20-5-1-7-24-17/h3-4,15H,1-2,5-14,19H2 |
| InChIKey | IAZUKTCIDKRIEE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|