C9H7NO2 — CID 83914245
6-isocyanato-2,3-dihydro-1-benzofuran (PubChem CID 83914245) has the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. Its IUPAC name is 6-isocyanato-2,3-dihydro-1-benzofuran.
| Compound Name | 6-isocyanato-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 83914245 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 6-isocyanato-2,3-dihydro-1-benzofuran |
| SMILES | O=C=Nc1ccc2c(c1)OCC2 |
| InChI | InChI=1S/C9H7NO2/c11-6-10-8-2-1-7-3-4-12-9(7)5-8/h1-2,5H,3-4H2 |
| InChIKey | VKWMKHXBPDWQBP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|