C10H8FNO2 — CID 117283360
6-fluoro-5-(isocyanatomethyl)-2,3-dihydro-1-benzofuran (PubChem CID 117283360) has the molecular formula C10H8FNO2 and a molecular weight of 193.18 g/mol. Its IUPAC name is 6-fluoro-5-(isocyanatomethyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 6-fluoro-5-(isocyanatomethyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 117283360 |
| Molecular Formula | C10H8FNO2 |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 6-fluoro-5-(isocyanatomethyl)-2,3-dihydro-1-benzofuran |
| SMILES | O=C=NCc1cc2c(cc1F)OCC2 |
| InChI | InChI=1S/C10H8FNO2/c11-9-4-10-7(1-2-14-10)3-8(9)5-12-6-13/h3-4H,1-2,5H2 |
| InChIKey | PPYJFDAKDXZUEI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|