C8H4F3NO2 — CID 117291250
2,3,4-trifluoro-6-(isocyanatomethyl)phenol (PubChem CID 117291250) has the molecular formula C8H4F3NO2 and a molecular weight of 203.12 g/mol. Its IUPAC name is 2,3,4-trifluoro-6-(isocyanatomethyl)phenol.
| Compound Name | 2,3,4-trifluoro-6-(isocyanatomethyl)phenol |
|---|---|
| PubChem CID | 117291250 |
| Molecular Formula | C8H4F3NO2 |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 2,3,4-trifluoro-6-(isocyanatomethyl)phenol |
| SMILES | O=C=NCc1cc(F)c(F)c(F)c1O |
| InChI | InChI=1S/C8H4F3NO2/c9-5-1-4(2-12-3-13)8(14)7(11)6(5)10/h1,14H,2H2 |
| InChIKey | BZGJVZMCMAPMQN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|