C9H7F2NOS — CID 117306426
1,4-difluoro-2-(isocyanatomethyl)-5-methylsulfanylbenzene (PubChem CID 117306426) has the molecular formula C9H7F2NOS and a molecular weight of 215.22 g/mol. Its IUPAC name is 1,4-difluoro-2-(isocyanatomethyl)-5-methylsulfanylbenzene.
| Compound Name | 1,4-difluoro-2-(isocyanatomethyl)-5-methylsulfanylbenzene |
|---|---|
| PubChem CID | 117306426 |
| Molecular Formula | C9H7F2NOS |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 1,4-difluoro-2-(isocyanatomethyl)-5-methylsulfanylbenzene |
| SMILES | CSc1cc(F)c(CN=C=O)cc1F |
| InChI | InChI=1S/C9H7F2NOS/c1-14-9-3-7(10)6(2-8(9)11)4-12-5-13/h2-3H,4H2,1H3 |
| InChIKey | BLYGAKXZULBLQR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|