C12H11FN2O — CID 117310743
5-fluoro-6-(isocyanatomethyl)-1,2-dimethylindole (PubChem CID 117310743) has the molecular formula C12H11FN2O and a molecular weight of 218.23 g/mol. Its IUPAC name is 5-fluoro-6-(isocyanatomethyl)-1,2-dimethylindole.
| Compound Name | 5-fluoro-6-(isocyanatomethyl)-1,2-dimethylindole |
|---|---|
| PubChem CID | 117310743 |
| Molecular Formula | C12H11FN2O |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 5-fluoro-6-(isocyanatomethyl)-1,2-dimethylindole |
| SMILES | Cc1cc2cc(F)c(CN=C=O)cc2n1C |
| InChI | InChI=1S/C12H11FN2O/c1-8-3-9-4-11(13)10(6-14-7-16)5-12(9)15(8)2/h3-5H,6H2,1-2H3 |
| InChIKey | NPBNAVFOYKYOHZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|