C8H3ClF3NO — CID 117114804
3-chloro-1,2,4-trifluoro-5-(isocyanatomethyl)benzene (PubChem CID 117114804) has the molecular formula C8H3ClF3NO and a molecular weight of 221.56 g/mol. Its IUPAC name is 3-chloro-1,2,4-trifluoro-5-(isocyanatomethyl)benzene.
| Compound Name | 3-chloro-1,2,4-trifluoro-5-(isocyanatomethyl)benzene |
|---|---|
| PubChem CID | 117114804 |
| Molecular Formula | C8H3ClF3NO |
| Molecular Weight | 221.56 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | 3-chloro-1,2,4-trifluoro-5-(isocyanatomethyl)benzene |
| SMILES | O=C=NCc1cc(F)c(F)c(Cl)c1F |
| InChI | InChI=1S/C8H3ClF3NO/c9-6-7(11)4(2-13-3-14)1-5(10)8(6)12/h1H,2H2 |
| InChIKey | JFTONAUFEQHDAG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|