C8H4Cl3NO — CID 21478113
1,2,5-trichloro-3-(isocyanatomethyl)benzene (PubChem CID 21478113) has the molecular formula C8H4Cl3NO and a molecular weight of 236.48 g/mol. Its IUPAC name is 1,2,5-trichloro-3-(isocyanatomethyl)benzene.
| Compound Name | 1,2,5-trichloro-3-(isocyanatomethyl)benzene |
|---|---|
| PubChem CID | 21478113 |
| Molecular Formula | C8H4Cl3NO |
| Molecular Weight | 236.48 g/mol |
| Exact Mass | 234.94 |
| IUPAC Name | 1,2,5-trichloro-3-(isocyanatomethyl)benzene |
| SMILES | O=C=NCc1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C8H4Cl3NO/c9-6-1-5(3-12-4-13)8(11)7(10)2-6/h1-2H,3H2 |
| InChIKey | ZEDOCBHUIDCJAZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|