C12H14ClNO3 — CID 117392169
3-chloro-1-ethyl-5-(isocyanatomethyl)-2,4-dimethoxybenzene (PubChem CID 117392169) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 3-chloro-1-ethyl-5-(isocyanatomethyl)-2,4-dimethoxybenzene.
| Compound Name | 3-chloro-1-ethyl-5-(isocyanatomethyl)-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 117392169 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-chloro-1-ethyl-5-(isocyanatomethyl)-2,4-dimethoxybenzene |
| SMILES | CCc1cc(CN=C=O)c(OC)c(Cl)c1OC |
| InChI | InChI=1S/C12H14ClNO3/c1-4-8-5-9(6-14-7-15)12(17-3)10(13)11(8)16-2/h5H,4,6H2,1-3H3 |
| InChIKey | DMSULBFHCLGYNX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|