C9H7F2NO2 — CID 117288170
1,5-difluoro-3-(isocyanatomethyl)-2-methoxybenzene (PubChem CID 117288170) has the molecular formula C9H7F2NO2 and a molecular weight of 199.16 g/mol. Its IUPAC name is 1,5-difluoro-3-(isocyanatomethyl)-2-methoxybenzene.
| Compound Name | 1,5-difluoro-3-(isocyanatomethyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 117288170 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 1,5-difluoro-3-(isocyanatomethyl)-2-methoxybenzene |
| SMILES | COc1c(F)cc(F)cc1CN=C=O |
| InChI | InChI=1S/C9H7F2NO2/c1-14-9-6(4-12-5-13)2-7(10)3-8(9)11/h2-3H,4H2,1H3 |
| InChIKey | KGJFIBCVKZVODA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|