C10H12F2O — CID 176962400
1,5-difluoro-2-methoxy-3-propylbenzene (PubChem CID 176962400) has the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. Its IUPAC name is 1,5-difluoro-2-methoxy-3-propylbenzene.
| Compound Name | 1,5-difluoro-2-methoxy-3-propylbenzene |
|---|---|
| PubChem CID | 176962400 |
| Molecular Formula | C10H12F2O |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 1,5-difluoro-2-methoxy-3-propylbenzene |
| SMILES | CCCc1cc(F)cc(F)c1OC |
| InChI | InChI=1S/C10H12F2O/c1-3-4-7-5-8(11)6-9(12)10(7)13-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | BQPGHTJFSYYLOA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |