C10H13F2NO2 — CID 117309017
2-(3,5-difluoro-2,6-dimethoxyphenyl)ethanamine (PubChem CID 117309017) has the molecular formula C10H13F2NO2 and a molecular weight of 217.21 g/mol. Its IUPAC name is 2-(3,5-difluoro-2,6-dimethoxyphenyl)ethanamine.
| Compound Name | 2-(3,5-difluoro-2,6-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 117309017 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-(3,5-difluoro-2,6-dimethoxyphenyl)ethanamine |
| SMILES | COc1c(F)cc(F)c(OC)c1CCN |
| InChI | InChI=1S/C10H13F2NO2/c1-14-9-6(3-4-13)10(15-2)8(12)5-7(9)11/h5H,3-4,13H2,1-2H3 |
| InChIKey | IKKLKWWBRWBTEI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |