C11H14ClF2NO — CID 117377898
4-(3-chloro-2,5-difluoro-6-methoxyphenyl)butan-1-amine (PubChem CID 117377898) has the molecular formula C11H14ClF2NO and a molecular weight of 249.69 g/mol. Its IUPAC name is 4-(3-chloro-2,5-difluoro-6-methoxyphenyl)butan-1-amine.
| Compound Name | 4-(3-chloro-2,5-difluoro-6-methoxyphenyl)butan-1-amine |
|---|---|
| PubChem CID | 117377898 |
| Molecular Formula | C11H14ClF2NO |
| Molecular Weight | 249.69 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 4-(3-chloro-2,5-difluoro-6-methoxyphenyl)butan-1-amine |
| SMILES | COc1c(F)cc(Cl)c(F)c1CCCCN |
| InChI | InChI=1S/C11H14ClF2NO/c1-16-11-7(4-2-3-5-15)10(14)8(12)6-9(11)13/h6H,2-5,15H2,1H3 |
| InChIKey | ODWWEAIXKWMZBH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|