C11H15ClFN — CID 117307547
3-(3-chloro-2-fluoro-5,6-dimethylphenyl)propan-1-amine (PubChem CID 117307547) has the molecular formula C11H15ClFN and a molecular weight of 215.70 g/mol. Its IUPAC name is 3-(3-chloro-2-fluoro-5,6-dimethylphenyl)propan-1-amine.
| Compound Name | 3-(3-chloro-2-fluoro-5,6-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 117307547 |
| Molecular Formula | C11H15ClFN |
| Molecular Weight | 215.70 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-(3-chloro-2-fluoro-5,6-dimethylphenyl)propan-1-amine |
| SMILES | Cc1cc(Cl)c(F)c(CCCN)c1C |
| InChI | InChI=1S/C11H15ClFN/c1-7-6-10(12)11(13)9(8(7)2)4-3-5-14/h6H,3-5,14H2,1-2H3 |
| InChIKey | AOEUOLDSKUEIMI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.70 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |