C8H7ClF3N — CID 117299579
2-(3-chloro-2,5,6-trifluorophenyl)ethanamine (PubChem CID 117299579) has the molecular formula C8H7ClF3N and a molecular weight of 209.60 g/mol. Its IUPAC name is 2-(3-chloro-2,5,6-trifluorophenyl)ethanamine.
| Compound Name | 2-(3-chloro-2,5,6-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 117299579 |
| Molecular Formula | C8H7ClF3N |
| Molecular Weight | 209.60 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 2-(3-chloro-2,5,6-trifluorophenyl)ethanamine |
| SMILES | NCCc1c(F)c(F)cc(Cl)c1F |
| InChI | InChI=1S/C8H7ClF3N/c9-5-3-6(10)8(12)4(1-2-13)7(5)11/h3H,1-2,13H2 |
| InChIKey | XKOQXRKPEOPWPL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.60 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|