C8H8ClF2N — CID 117282784
2-(3-chloro-4,5-difluorophenyl)ethanamine (PubChem CID 117282784) has the molecular formula C8H8ClF2N and a molecular weight of 191.61 g/mol. Its IUPAC name is 2-(3-chloro-4,5-difluorophenyl)ethanamine.
| Compound Name | 2-(3-chloro-4,5-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 117282784 |
| Molecular Formula | C8H8ClF2N |
| Molecular Weight | 191.61 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 2-(3-chloro-4,5-difluorophenyl)ethanamine |
| SMILES | NCCc1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C8H8ClF2N/c9-6-3-5(1-2-12)4-7(10)8(6)11/h3-4H,1-2,12H2 |
| InChIKey | FKBXYUZOSUMLIG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.61 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|