C8H8ClF2NO — CID 83883525
2-(2-aminoethyl)-6-chloro-3,4-difluorophenol (PubChem CID 83883525) has the molecular formula C8H8ClF2NO and a molecular weight of 207.61 g/mol. Its IUPAC name is 2-(2-aminoethyl)-6-chloro-3,4-difluorophenol.
| Compound Name | 2-(2-aminoethyl)-6-chloro-3,4-difluorophenol |
|---|---|
| PubChem CID | 83883525 |
| Molecular Formula | C8H8ClF2NO |
| Molecular Weight | 207.61 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 2-(2-aminoethyl)-6-chloro-3,4-difluorophenol |
| SMILES | NCCc1c(O)c(Cl)cc(F)c1F |
| InChI | InChI=1S/C8H8ClF2NO/c9-5-3-6(10)7(11)4(1-2-12)8(5)13/h3,13H,1-2,12H2 |
| InChIKey | JXXUNARSVMOALD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.61 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|