C9H10BrF2NO — CID 83902395
2-(3-aminopropyl)-6-bromo-3,4-difluorophenol (PubChem CID 83902395) has the molecular formula C9H10BrF2NO and a molecular weight of 266.08 g/mol. Its IUPAC name is 2-(3-aminopropyl)-6-bromo-3,4-difluorophenol.
| Compound Name | 2-(3-aminopropyl)-6-bromo-3,4-difluorophenol |
|---|---|
| PubChem CID | 83902395 |
| Molecular Formula | C9H10BrF2NO |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 2-(3-aminopropyl)-6-bromo-3,4-difluorophenol |
| SMILES | NCCCc1c(O)c(Br)cc(F)c1F |
| InChI | InChI=1S/C9H10BrF2NO/c10-6-4-7(11)8(12)5(9(6)14)2-1-3-13/h4,14H,1-3,13H2 |
| InChIKey | PINFNWSLVQOGPM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|