C10H11BrF3N — CID 117115711
4-(3-bromo-2,5,6-trifluorophenyl)butan-1-amine (PubChem CID 117115711) has the molecular formula C10H11BrF3N and a molecular weight of 282.10 g/mol. Its IUPAC name is 4-(3-bromo-2,5,6-trifluorophenyl)butan-1-amine.
| Compound Name | 4-(3-bromo-2,5,6-trifluorophenyl)butan-1-amine |
|---|---|
| PubChem CID | 117115711 |
| Molecular Formula | C10H11BrF3N |
| Molecular Weight | 282.10 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 4-(3-bromo-2,5,6-trifluorophenyl)butan-1-amine |
| SMILES | NCCCCc1c(F)c(F)cc(Br)c1F |
| InChI | InChI=1S/C10H11BrF3N/c11-7-5-8(12)10(14)6(9(7)13)3-1-2-4-15/h5H,1-4,15H2 |
| InChIKey | FUUKBODDVKZEOQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.10 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|