C7H3Br2F3 — CID 131214209
1,3-dibromo-4,5-difluoro-2-(fluoromethyl)benzene (PubChem CID 131214209) has the molecular formula C7H3Br2F3 and a molecular weight of 303.90 g/mol. Its IUPAC name is 1,3-dibromo-4,5-difluoro-2-(fluoromethyl)benzene.
| Compound Name | 1,3-dibromo-4,5-difluoro-2-(fluoromethyl)benzene |
|---|---|
| PubChem CID | 131214209 |
| Molecular Formula | C7H3Br2F3 |
| Molecular Weight | 303.90 g/mol |
| Exact Mass | 301.86 |
| IUPAC Name | 1,3-dibromo-4,5-difluoro-2-(fluoromethyl)benzene |
| SMILES | FCc1c(Br)cc(F)c(F)c1Br |
| InChI | InChI=1S/C7H3Br2F3/c8-4-1-5(11)7(12)6(9)3(4)2-10/h1H,2H2 |
| InChIKey | RAYHMMKWTNJKRA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.90 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|